C16H19N3O3 — CID 74249111
N-cyclopropyl-6-(3,4,5-trimethoxyphenyl)pyridazin-3-amine (PubChem CID 74249111) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-cyclopropyl-6-(3,4,5-trimethoxyphenyl)pyridazin-3-amine.
| Compound Name | N-cyclopropyl-6-(3,4,5-trimethoxyphenyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 74249111 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-cyclopropyl-6-(3,4,5-trimethoxyphenyl)pyridazin-3-amine |
| SMILES | COc1cc(-c2ccc(NC3CC3)nn2)cc(OC)c1OC |
| InChI | InChI=1S/C16H19N3O3/c1-20-13-8-10(9-14(21-2)16(13)22-3)12-6-7-15(19-18-12)17-11-4-5-11/h6-9,11H,4-5H2,1-3H3,(H,17,19) |
| InChIKey | ILJUZVORAJXQOR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |