C15H18N2O3S — CID 7672970
3-ethylsulfanyl-6-(3,4,5-trimethoxyphenyl)pyridazine (PubChem CID 7672970) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-ethylsulfanyl-6-(3,4,5-trimethoxyphenyl)pyridazine.
| Compound Name | 3-ethylsulfanyl-6-(3,4,5-trimethoxyphenyl)pyridazine |
|---|---|
| PubChem CID | 7672970 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-ethylsulfanyl-6-(3,4,5-trimethoxyphenyl)pyridazine |
| SMILES | CCSc1ccc(-c2cc(OC)c(OC)c(OC)c2)nn1 |
| InChI | InChI=1S/C15H18N2O3S/c1-5-21-14-7-6-11(16-17-14)10-8-12(18-2)15(20-4)13(9-10)19-3/h6-9H,5H2,1-4H3 |
| InChIKey | FKSJRIRKIKVYBA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |