C15H28O3S — CID 143026754
ethane;5-ethylsulfanyl-1,2,3-trimethoxybenzene (PubChem CID 143026754) has the molecular formula C15H28O3S and a molecular weight of 288.45 g/mol. Its IUPAC name is ethane;5-ethylsulfanyl-1,2,3-trimethoxybenzene.
| Compound Name | ethane;5-ethylsulfanyl-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 143026754 |
| Molecular Formula | C15H28O3S |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | ethane;5-ethylsulfanyl-1,2,3-trimethoxybenzene |
| SMILES | CC.CC.CCSc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C11H16O3S.2C2H6/c1-5-15-8-6-9(12-2)11(14-4)10(7-8)13-3;2*1-2/h6-7H,5H2,1-4H3;2*1-2H3 |
| InChIKey | XOOSLBCUAUNLHY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |