C20H21N3O5 — CID 67422117
3-(3,4-dimethoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-1,2,4-triazine (PubChem CID 67422117) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-1,2,4-triazine.
| Compound Name | 3-(3,4-dimethoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 67422117 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-6-(3,4,5-trimethoxyphenyl)-1,2,4-triazine |
| SMILES | COc1ccc(-c2ncc(-c3cc(OC)c(OC)c(OC)c3)nn2)cc1OC |
| InChI | InChI=1S/C20H21N3O5/c1-24-15-7-6-12(8-16(15)25-2)20-21-11-14(22-23-20)13-9-17(26-3)19(28-5)18(10-13)27-4/h6-11H,1-5H3 |
| InChIKey | BWOYTSQWJAONOO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |