C22H22N2O7 — CID 6418724
[6-(3,4-dimethoxyphenyl)pyridazin-3-yl] 3,4,5-trimethoxybenzoate (PubChem CID 6418724) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is [6-(3,4-dimethoxyphenyl)pyridazin-3-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [6-(3,4-dimethoxyphenyl)pyridazin-3-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 6418724 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [6-(3,4-dimethoxyphenyl)pyridazin-3-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1ccc(-c2ccc(OC(=O)c3cc(OC)c(OC)c(OC)c3)nn2)cc1OC |
| InChI | InChI=1S/C22H22N2O7/c1-26-16-8-6-13(10-17(16)27-2)15-7-9-20(24-23-15)31-22(25)14-11-18(28-3)21(30-5)19(12-14)29-4/h6-12H,1-5H3 |
| InChIKey | DJZBZYBCLIOPQZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |