C14H13NO4 — CID 35206042
pyridin-2-yl 3,4-dimethoxybenzoate (PubChem CID 35206042) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is pyridin-2-yl 3,4-dimethoxybenzoate.
| Compound Name | pyridin-2-yl 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 35206042 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | pyridin-2-yl 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccn2)cc1OC |
| InChI | InChI=1S/C14H13NO4/c1-17-11-7-6-10(9-12(11)18-2)14(16)19-13-5-3-4-8-15-13/h3-9H,1-2H3 |
| InChIKey | JYLBXVWUNRTGSA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |