C12H12N2O3 — CID 5058351
(3,4-dimethoxyphenyl)-pyrazol-1-ylmethanone (PubChem CID 5058351) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-pyrazol-1-ylmethanone.
| Compound Name | (3,4-dimethoxyphenyl)-pyrazol-1-ylmethanone |
|---|---|
| PubChem CID | 5058351 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (3,4-dimethoxyphenyl)-pyrazol-1-ylmethanone |
| SMILES | COc1ccc(C(=O)n2cccn2)cc1OC |
| InChI | InChI=1S/C12H12N2O3/c1-16-10-5-4-9(8-11(10)17-2)12(15)14-7-3-6-13-14/h3-8H,1-2H3 |
| InChIKey | BQAVKDMOPOBCQH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |