C12H12N2O — CID 4592598
(3,4-dimethylphenyl)-pyrazol-1-ylmethanone (PubChem CID 4592598) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-pyrazol-1-ylmethanone.
| Compound Name | (3,4-dimethylphenyl)-pyrazol-1-ylmethanone |
|---|---|
| PubChem CID | 4592598 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | (3,4-dimethylphenyl)-pyrazol-1-ylmethanone |
| SMILES | Cc1ccc(C(=O)n2cccn2)cc1C |
| InChI | InChI=1S/C12H12N2O/c1-9-4-5-11(8-10(9)2)12(15)14-7-3-6-13-14/h3-8H,1-2H3 |
| InChIKey | WDJYWYXNOYLFKL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |