C24H25N3O2 — CID 110347050
[4-(3,4-dimethylbenzoyl)piperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone (PubChem CID 110347050) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is [4-(3,4-dimethylbenzoyl)piperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone.
| Compound Name | [4-(3,4-dimethylbenzoyl)piperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 110347050 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | [4-(3,4-dimethylbenzoyl)piperazin-1-yl]-(4-pyrrol-1-ylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)c3ccc(-n4cccc4)cc3)CC2)cc1C |
| InChI | InChI=1S/C24H25N3O2/c1-18-5-6-21(17-19(18)2)24(29)27-15-13-26(14-16-27)23(28)20-7-9-22(10-8-20)25-11-3-4-12-25/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | XELLQIBGICODON-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |