C25H27N3O3 — CID 108535822
2-(3,4-dimethylphenoxy)-1-[4-(4-pyrrol-1-ylbenzoyl)piperazin-1-yl]ethanone (PubChem CID 108535822) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-1-[4-(4-pyrrol-1-ylbenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3,4-dimethylphenoxy)-1-[4-(4-pyrrol-1-ylbenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108535822 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-1-[4-(4-pyrrol-1-ylbenzoyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccc(OCC(=O)N2CCN(C(=O)c3ccc(-n4cccc4)cc3)CC2)cc1C |
| InChI | InChI=1S/C25H27N3O3/c1-19-5-10-23(17-20(19)2)31-18-24(29)27-13-15-28(16-14-27)25(30)21-6-8-22(9-7-21)26-11-3-4-12-26/h3-12,17H,13-16,18H2,1-2H3 |
| InChIKey | AKBBRXFMMRKBSR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |