About 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one
5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104735025) has the molecular formula C16H15N3O2
and a molecular weight of 281.32 g/mol. Its IUPAC name is 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one.
Molecular Properties
| Compound Name | 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one |
| PubChem CID | 104735025 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | Cc1ccc(C(=O)Cn2ccn3nccc3c2=O)cc1C |
| InChI | InChI=1S/C16H15N3O2/c1-11-3-4-13(9-12(11)2)15(20)10-18-7-8-19-14(16(18)21)5-6-17-19/h3-9H,10H2,1-2H3 |
| InChIKey | YJVZQQLYSSFGJB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one?
The IUPAC name of 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one (CID 104735025) is 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one.
What is the SMILES notation for 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one?
The canonical SMILES for 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one is Cc1ccc(C(=O)Cn2ccn3nccc3c2=O)cc1C.
What is the InChIKey of 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one?
The InChIKey is YJVZQQLYSSFGJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O2/c1-11-3-4-13(9-12(11)2)15(20)10-18-7-8-19-14(16(18)21)5-6-17-19/h3-9H,10H2,1-2H3.
What are the key properties of 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one?
5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one has a molecular weight of 281.32 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,4-dimethylphenyl)-2-oxoethyl]pyrazolo[1,5-a]pyrazin-4-one is sourced from PubChem (CID 104735025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).