C18H16N2O2 — CID 932622
3-[2-(3,4-dimethylphenyl)-2-oxoethyl]quinazolin-4-one (PubChem CID 932622) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-[2-(3,4-dimethylphenyl)-2-oxoethyl]quinazolin-4-one.
| Compound Name | 3-[2-(3,4-dimethylphenyl)-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 932622 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[2-(3,4-dimethylphenyl)-2-oxoethyl]quinazolin-4-one |
| SMILES | Cc1ccc(C(=O)Cn2cnc3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C18H16N2O2/c1-12-7-8-14(9-13(12)2)17(21)10-20-11-19-16-6-4-3-5-15(16)18(20)22/h3-9,11H,10H2,1-2H3 |
| InChIKey | XGMULQJOKRAFJU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |