C18H16N2O3 — CID 9097161
(3,4-dimethylphenyl) 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 9097161) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | (3,4-dimethylphenyl) 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 9097161 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (3,4-dimethylphenyl) 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | Cc1ccc(OC(=O)Cn2cnc3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C18H16N2O3/c1-12-7-8-14(9-13(12)2)23-17(21)10-20-11-19-16-6-4-3-5-15(16)18(20)22/h3-9,11H,10H2,1-2H3 |
| InChIKey | HWLFBOLGKDCJFF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|