C17H21N3O — CID 110871165
(3,4-dimethylphenyl)-(4-pyrazol-1-ylpiperidin-1-yl)methanone (PubChem CID 110871165) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(4-pyrazol-1-ylpiperidin-1-yl)methanone.
| Compound Name | (3,4-dimethylphenyl)-(4-pyrazol-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 110871165 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (3,4-dimethylphenyl)-(4-pyrazol-1-ylpiperidin-1-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(n3cccn3)CC2)cc1C |
| InChI | InChI=1S/C17H21N3O/c1-13-4-5-15(12-14(13)2)17(21)19-10-6-16(7-11-19)20-9-3-8-18-20/h3-5,8-9,12,16H,6-7,10-11H2,1-2H3 |
| InChIKey | NVFGWUZUMKRCEV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |