C14H17N3O2 — CID 136533921
(5-methylfuran-3-yl)-(4-pyrazol-1-ylpiperidin-1-yl)methanone (PubChem CID 136533921) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (5-methylfuran-3-yl)-(4-pyrazol-1-ylpiperidin-1-yl)methanone.
| Compound Name | (5-methylfuran-3-yl)-(4-pyrazol-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 136533921 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (5-methylfuran-3-yl)-(4-pyrazol-1-ylpiperidin-1-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC(n3cccn3)CC2)co1 |
| InChI | InChI=1S/C14H17N3O2/c1-11-9-12(10-19-11)14(18)16-7-3-13(4-8-16)17-6-2-5-15-17/h2,5-6,9-10,13H,3-4,7-8H2,1H3 |
| InChIKey | PJYIXPHOPNBBAM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |