C10H15N3O4S — CID 114822701
4-(5-methylfuran-3-carbonyl)piperazine-1-sulfonamide (PubChem CID 114822701) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 4-(5-methylfuran-3-carbonyl)piperazine-1-sulfonamide.
| Compound Name | 4-(5-methylfuran-3-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 114822701 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-(5-methylfuran-3-carbonyl)piperazine-1-sulfonamide |
| SMILES | Cc1cc(C(=O)N2CCN(S(N)(=O)=O)CC2)co1 |
| InChI | InChI=1S/C10H15N3O4S/c1-8-6-9(7-17-8)10(14)12-2-4-13(5-3-12)18(11,15)16/h6-7H,2-5H2,1H3,(H2,11,15,16) |
| InChIKey | UDGHPIADKIBZSQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |