C11H13Br2N3O3S — CID 103908474
4-(3,5-dibromobenzoyl)piperazine-1-sulfonamide (PubChem CID 103908474) has the molecular formula C11H13Br2N3O3S and a molecular weight of 427.12 g/mol. Its IUPAC name is 4-(3,5-dibromobenzoyl)piperazine-1-sulfonamide.
| Compound Name | 4-(3,5-dibromobenzoyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 103908474 |
| Molecular Formula | C11H13Br2N3O3S |
| Molecular Weight | 427.12 g/mol |
| Exact Mass | 424.90 |
| IUPAC Name | 4-(3,5-dibromobenzoyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)c2cc(Br)cc(Br)c2)CC1 |
| InChI | InChI=1S/C11H13Br2N3O3S/c12-9-5-8(6-10(13)7-9)11(17)15-1-3-16(4-2-15)20(14,18)19/h5-7H,1-4H2,(H2,14,18,19) |
| InChIKey | QFGVUOPRLRCQAF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.12 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |