C12H14Br2N2O3S — CID 103907500
(3,5-dibromophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 103907500) has the molecular formula C12H14Br2N2O3S and a molecular weight of 426.13 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (3,5-dibromophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 103907500 |
| Molecular Formula | C12H14Br2N2O3S |
| Molecular Weight | 426.13 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | (3,5-dibromophenyl)-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2cc(Br)cc(Br)c2)CC1 |
| InChI | InChI=1S/C12H14Br2N2O3S/c1-20(18,19)16-4-2-15(3-5-16)12(17)9-6-10(13)8-11(14)7-9/h6-8H,2-5H2,1H3 |
| InChIKey | BTNCSRXWYBWONC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.13 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |