C21H16N2O5 — CID 110494726
(2-pyridin-2-yl-1,3-benzoxazol-6-yl) 3,4-dimethoxybenzoate (PubChem CID 110494726) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 3,4-dimethoxybenzoate.
| Compound Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 110494726 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3nc(-c4ccccn4)oc3c2)cc1OC |
| InChI | InChI=1S/C21H16N2O5/c1-25-17-9-6-13(11-19(17)26-2)21(24)27-14-7-8-15-18(12-14)28-20(23-15)16-5-3-4-10-22-16/h3-12H,1-2H3 |
| InChIKey | UWXQMVUPATYKLF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|