C21H16N2O4 — CID 110494824
(2-pyridin-2-yl-1,3-benzoxazol-6-yl) 3-ethoxybenzoate (PubChem CID 110494824) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 3-ethoxybenzoate.
| Compound Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 3-ethoxybenzoate |
|---|---|
| PubChem CID | 110494824 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 3-ethoxybenzoate |
| SMILES | CCOc1cccc(C(=O)Oc2ccc3nc(-c4ccccn4)oc3c2)c1 |
| InChI | InChI=1S/C21H16N2O4/c1-2-25-15-7-5-6-14(12-15)21(24)26-16-9-10-17-19(13-16)27-20(23-17)18-8-3-4-11-22-18/h3-13H,2H2,1H3 |
| InChIKey | FUHOKTNZYASBKT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|