C21H17N3O5S — CID 110494740
(2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-(dimethylsulfamoyl)benzoate (PubChem CID 110494740) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-(dimethylsulfamoyl)benzoate.
| Compound Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 110494740 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 4-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Oc2ccc3nc(-c4ccccn4)oc3c2)cc1 |
| InChI | InChI=1S/C21H17N3O5S/c1-24(2)30(26,27)16-9-6-14(7-10-16)21(25)28-15-8-11-17-19(13-15)29-20(23-17)18-5-3-4-12-22-18/h3-13H,1-2H3 |
| InChIKey | KWELOWXAKWBJTG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|