C20H12Cl2N2O4 — CID 110494737
(2-pyridin-2-yl-1,3-benzoxazol-6-yl) 2-(2,4-dichlorophenoxy)acetate (PubChem CID 110494737) has the molecular formula C20H12Cl2N2O4 and a molecular weight of 415.23 g/mol. Its IUPAC name is (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 110494737 |
| Molecular Formula | C20H12Cl2N2O4 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | (2-pyridin-2-yl-1,3-benzoxazol-6-yl) 2-(2,4-dichlorophenoxy)acetate |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Oc1ccc2nc(-c3ccccn3)oc2c1 |
| InChI | InChI=1S/C20H12Cl2N2O4/c21-12-4-7-17(14(22)9-12)26-11-19(25)27-13-5-6-15-18(10-13)28-20(24-15)16-3-1-2-8-23-16/h1-10H,11H2 |
| InChIKey | UAPALNIOTMEQDL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|