C23H18Cl2O6 — CID 17161809
2-phenoxyethyl 3-[2-(2,4-dichlorophenoxy)acetyl]oxybenzoate (PubChem CID 17161809) has the molecular formula C23H18Cl2O6 and a molecular weight of 461.30 g/mol. Its IUPAC name is 2-phenoxyethyl 3-[2-(2,4-dichlorophenoxy)acetyl]oxybenzoate.
| Compound Name | 2-phenoxyethyl 3-[2-(2,4-dichlorophenoxy)acetyl]oxybenzoate |
|---|---|
| PubChem CID | 17161809 |
| Molecular Formula | C23H18Cl2O6 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 2-phenoxyethyl 3-[2-(2,4-dichlorophenoxy)acetyl]oxybenzoate |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Oc1cccc(C(=O)OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C23H18Cl2O6/c24-17-9-10-21(20(25)14-17)30-15-22(26)31-19-8-4-5-16(13-19)23(27)29-12-11-28-18-6-2-1-3-7-18/h1-10,13-14H,11-12,15H2 |
| InChIKey | UQPATHGTTKDONG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|