C16H14Cl2N2O4 — CID 8803795
2-(2,4-dichlorophenoxy)ethyl 3-(carbamoylamino)benzoate (PubChem CID 8803795) has the molecular formula C16H14Cl2N2O4 and a molecular weight of 369.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl 3-(carbamoylamino)benzoate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl 3-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 8803795 |
| Molecular Formula | C16H14Cl2N2O4 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl 3-(carbamoylamino)benzoate |
| SMILES | NC(=O)Nc1cccc(C(=O)OCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O4/c17-11-4-5-14(13(18)9-11)23-6-7-24-15(21)10-2-1-3-12(8-10)20-16(19)22/h1-5,8-9H,6-7H2,(H3,19,20,22) |
| InChIKey | LVDGKBHVAWUCSV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|