C25H30Cl2O5 — CID 87940027
[2-(2,4-dichlorophenoxy)acetyl] 11-phenoxyundecanoate (PubChem CID 87940027) has the molecular formula C25H30Cl2O5 and a molecular weight of 481.42 g/mol. Its IUPAC name is [2-(2,4-dichlorophenoxy)acetyl] 11-phenoxyundecanoate.
| Compound Name | [2-(2,4-dichlorophenoxy)acetyl] 11-phenoxyundecanoate |
|---|---|
| PubChem CID | 87940027 |
| Molecular Formula | C25H30Cl2O5 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | [2-(2,4-dichlorophenoxy)acetyl] 11-phenoxyundecanoate |
| SMILES | O=C(CCCCCCCCCCOc1ccccc1)OC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H30Cl2O5/c26-20-15-16-23(22(27)18-20)31-19-25(29)32-24(28)14-10-5-3-1-2-4-6-11-17-30-21-12-8-7-9-13-21/h7-9,12-13,15-16,18H,1-6,10-11,14,17,19H2 |
| InChIKey | GRPORRMSQJPHEN-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|