About 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide
2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide (PubChem CID 43817505) has the molecular formula C15H17N3O3S
and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide.
Molecular Properties
| Compound Name | 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide |
| PubChem CID | 43817505 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide |
| SMILES | COc1ccc(-c2ccc(SC(C)C(N)=O)nn2)cc1OC |
| InChI | InChI=1S/C15H17N3O3S/c1-9(15(16)19)22-14-7-5-11(17-18-14)10-4-6-12(20-2)13(8-10)21-3/h4-9H,1-3H3,(H2,16,19) |
| InChIKey | ZNJLAUKWXZPCPU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide?
The IUPAC name of 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide (CID 43817505) is 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide.
What is the SMILES notation for 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide?
The canonical SMILES for 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide is COc1ccc(-c2ccc(SC(C)C(N)=O)nn2)cc1OC.
What is the InChIKey of 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide?
The InChIKey is ZNJLAUKWXZPCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3S/c1-9(15(16)19)22-14-7-5-11(17-18-14)10-4-6-12(20-2)13(8-10)21-3/h4-9H,1-3H3,(H2,16,19).
What are the key properties of 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide?
2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide has a molecular weight of 319.39 g/mol, XLogP of 2.13, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(3,4-dimethoxyphenyl)pyridazin-3-yl]sulfanylpropanamide is sourced from PubChem (CID 43817505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).