C16H12BrN3O — CID 156613211
3-(3-bromophenyl)-6-(4-methoxyphenyl)-1,2,4-triazine (PubChem CID 156613211) has the molecular formula C16H12BrN3O and a molecular weight of 342.20 g/mol. Its IUPAC name is 3-(3-bromophenyl)-6-(4-methoxyphenyl)-1,2,4-triazine.
| Compound Name | 3-(3-bromophenyl)-6-(4-methoxyphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 156613211 |
| Molecular Formula | C16H12BrN3O |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 3-(3-bromophenyl)-6-(4-methoxyphenyl)-1,2,4-triazine |
| SMILES | COc1ccc(-c2cnc(-c3cccc(Br)c3)nn2)cc1 |
| InChI | InChI=1S/C16H12BrN3O/c1-21-14-7-5-11(6-8-14)15-10-18-16(20-19-15)12-3-2-4-13(17)9-12/h2-10H,1H3 |
| InChIKey | YCFNFUDRHZODRR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |