About 4-(3-bromophenyl)-1,2-dimethoxybenzene
4-(3-bromophenyl)-1,2-dimethoxybenzene (PubChem CID 83666367) has the molecular formula C14H13BrO2
and a molecular weight of 293.16 g/mol. Its IUPAC name is 4-(3-bromophenyl)-1,2-dimethoxybenzene.
Molecular Properties
| Compound Name | 4-(3-bromophenyl)-1,2-dimethoxybenzene |
| PubChem CID | 83666367 |
| Molecular Formula | C14H13BrO2 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 4-(3-bromophenyl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(-c2cccc(Br)c2)cc1OC |
| InChI | InChI=1S/C14H13BrO2/c1-16-13-7-6-11(9-14(13)17-2)10-4-3-5-12(15)8-10/h3-9H,1-2H3 |
| InChIKey | BYRIIKLVIJFBLR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3-bromophenyl)-1,2-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromophenyl)-1,2-dimethoxybenzene?
The IUPAC name of 4-(3-bromophenyl)-1,2-dimethoxybenzene (CID 83666367) is 4-(3-bromophenyl)-1,2-dimethoxybenzene.
What is the SMILES notation for 4-(3-bromophenyl)-1,2-dimethoxybenzene?
The canonical SMILES for 4-(3-bromophenyl)-1,2-dimethoxybenzene is COc1ccc(-c2cccc(Br)c2)cc1OC.
What is the InChIKey of 4-(3-bromophenyl)-1,2-dimethoxybenzene?
The InChIKey is BYRIIKLVIJFBLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrO2/c1-16-13-7-6-11(9-14(13)17-2)10-4-3-5-12(15)8-10/h3-9H,1-2H3.
What are the key properties of 4-(3-bromophenyl)-1,2-dimethoxybenzene?
4-(3-bromophenyl)-1,2-dimethoxybenzene has a molecular weight of 293.16 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromophenyl)-1,2-dimethoxybenzene is sourced from PubChem (CID 83666367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).