C16H18O2 — CID 67818138
4-(3-ethylphenyl)-1,2-dimethoxybenzene (PubChem CID 67818138) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-(3-ethylphenyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(3-ethylphenyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 67818138 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 4-(3-ethylphenyl)-1,2-dimethoxybenzene |
| SMILES | CCc1cccc(-c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C16H18O2/c1-4-12-6-5-7-13(10-12)14-8-9-15(17-2)16(11-14)18-3/h5-11H,4H2,1-3H3 |
| InChIKey | YZPMXRAMGIHIGF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |