About N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline
N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline (PubChem CID 142218080) has the molecular formula C24H24F3NO3
and a molecular weight of 431.45 g/mol. Its IUPAC name is N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline.
Molecular Properties
| Compound Name | N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline |
| PubChem CID | 142218080 |
| Molecular Formula | C24H24F3NO3 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline |
| SMILES | CCN(Cc1cccc(-c2ccc(OC)c(OC)c2)c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F3NO3/c1-4-28(20-9-11-21(12-10-20)31-24(25,26)27)16-17-6-5-7-18(14-17)19-8-13-22(29-2)23(15-19)30-3/h5-15H,4,16H2,1-3H3 |
| InChIKey | FTDIVPUUBVHCQY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline?
The IUPAC name of N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline (CID 142218080) is N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline.
What is the SMILES notation for N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline?
The canonical SMILES for N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline is CCN(Cc1cccc(-c2ccc(OC)c(OC)c2)c1)c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline?
The InChIKey is FTDIVPUUBVHCQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24F3NO3/c1-4-28(20-9-11-21(12-10-20)31-24(25,26)27)16-17-6-5-7-18(14-17)19-8-13-22(29-2)23(15-19)30-3/h5-15H,4,16H2,1-3H3.
What are the key properties of N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline?
N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline has a molecular weight of 431.45 g/mol, XLogP of 6.30, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline is sourced from PubChem (CID 142218080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).