C24H24F3NO3 — CID 142218080
N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline (PubChem CID 142218080) has the molecular formula C24H24F3NO3 and a molecular weight of 431.45 g/mol. Its IUPAC name is N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline.
| Compound Name | N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 142218080 |
| Molecular Formula | C24H24F3NO3 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[[3-(3,4-dimethoxyphenyl)phenyl]methyl]-N-ethyl-4-(trifluoromethoxy)aniline |
| SMILES | CCN(Cc1cccc(-c2ccc(OC)c(OC)c2)c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F3NO3/c1-4-28(20-9-11-21(12-10-20)31-24(25,26)27)16-17-6-5-7-18(14-17)19-8-13-22(29-2)23(15-19)30-3/h5-15H,4,16H2,1-3H3 |
| InChIKey | FTDIVPUUBVHCQY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|