About 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine
1-ethyl-3-(3-ethylphenyl)benzene;methanediamine (PubChem CID 134305122) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine.
Molecular Properties
| Compound Name | 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine |
| PubChem CID | 134305122 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine |
| SMILES | CCc1cccc(-c2cccc(CC)c2)c1.NCN |
| InChI | InChI=1S/C16H18.CH6N2/c1-3-13-7-5-9-15(11-13)16-10-6-8-14(4-2)12-16;2-1-3/h5-12H,3-4H2,1-2H3;1-3H2 |
| InChIKey | WHGNZXPQXIESPM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine?
The IUPAC name of 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine (CID 134305122) is 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine.
What is the SMILES notation for 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine?
The canonical SMILES for 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine is CCc1cccc(-c2cccc(CC)c2)c1.NCN.
What is the InChIKey of 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine?
The InChIKey is WHGNZXPQXIESPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.CH6N2/c1-3-13-7-5-9-15(11-13)16-10-6-8-14(4-2)12-16;2-1-3/h5-12H,3-4H2,1-2H3;1-3H2.
What are the key properties of 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine?
1-ethyl-3-(3-ethylphenyl)benzene;methanediamine has a molecular weight of 256.39 g/mol, XLogP of 3.34, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-(3-ethylphenyl)benzene;methanediamine is sourced from PubChem (CID 134305122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).