C38H34 — CID 142394585
1-ethyl-3-[3-[3-[3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenyl]phenyl]phenyl]benzene (PubChem CID 142394585) has the molecular formula C38H34 and a molecular weight of 490.69 g/mol. Its IUPAC name is 1-ethyl-3-[3-[3-[3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenyl]phenyl]phenyl]benzene.
| Compound Name | 1-ethyl-3-[3-[3-[3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenyl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 142394585 |
| Molecular Formula | C38H34 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 1-ethyl-3-[3-[3-[3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenyl]phenyl]phenyl]benzene |
| SMILES | C/C=C\C(=C/C)c1cccc(-c2cccc(-c3cccc(-c4cccc(-c5cccc(CC)c5)c4)c3)c2)c1 |
| InChI | InChI=1S/C38H34/c1-4-12-29(6-3)31-15-8-17-33(24-31)35-19-10-21-37(26-35)38-22-11-20-36(27-38)34-18-9-16-32(25-34)30-14-7-13-28(5-2)23-30/h4,6-27H,5H2,1-3H3/b12-4-,29-6+ |
| InChIKey | YQGNSDBWBZMGBD-OTNOFSDDSA-N |
| XLogP | 10.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|