C30H27N — CID 123475710
N-(4-hexa-2,4-dien-3-ylphenyl)-4-(3-phenylphenyl)aniline (PubChem CID 123475710) has the molecular formula C30H27N and a molecular weight of 401.55 g/mol. Its IUPAC name is N-(4-hexa-2,4-dien-3-ylphenyl)-4-(3-phenylphenyl)aniline.
| Compound Name | N-(4-hexa-2,4-dien-3-ylphenyl)-4-(3-phenylphenyl)aniline |
|---|---|
| PubChem CID | 123475710 |
| Molecular Formula | C30H27N |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-(4-hexa-2,4-dien-3-ylphenyl)-4-(3-phenylphenyl)aniline |
| SMILES | CC=CC(=CC)c1ccc(Nc2ccc(-c3cccc(-c4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C30H27N/c1-3-9-23(4-2)25-14-18-29(19-15-25)31-30-20-16-26(17-21-30)28-13-8-12-27(22-28)24-10-6-5-7-11-24/h3-22,31H,1-2H3 |
| InChIKey | GWSOEOVGBABFFI-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|