C26H25N — CID 156827248
N-[4-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]phenyl]-4-phenylaniline (PubChem CID 156827248) has the molecular formula C26H25N and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[4-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]phenyl]-4-phenylaniline.
| Compound Name | N-[4-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 156827248 |
| Molecular Formula | C26H25N |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-[4-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]phenyl]-4-phenylaniline |
| SMILES | C=C(C)/C=C\C(=C/C)c1ccc(Nc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H25N/c1-4-21(11-10-20(2)3)23-12-16-25(17-13-23)27-26-18-14-24(15-19-26)22-8-6-5-7-9-22/h4-19,27H,2H2,1,3H3/b11-10-,21-4+ |
| InChIKey | NONPZUDASKQWBE-WNPUVNSFSA-N |
| XLogP | 7.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|