C37H31N — CID 170214589
4-[4-[(3E,5Z)-5,6-diphenylhepta-1,3,5-trien-3-yl]phenyl]-N-phenylaniline (PubChem CID 170214589) has the molecular formula C37H31N and a molecular weight of 489.66 g/mol. Its IUPAC name is 4-[4-[(3E,5Z)-5,6-diphenylhepta-1,3,5-trien-3-yl]phenyl]-N-phenylaniline.
| Compound Name | 4-[4-[(3E,5Z)-5,6-diphenylhepta-1,3,5-trien-3-yl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 170214589 |
| Molecular Formula | C37H31N |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 4-[4-[(3E,5Z)-5,6-diphenylhepta-1,3,5-trien-3-yl]phenyl]-N-phenylaniline |
| SMILES | C=C/C(=C\C(=C(/C)c1ccccc1)c1ccccc1)c1ccc(-c2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H31N/c1-3-29(27-37(34-15-9-5-10-16-34)28(2)30-13-7-4-8-14-30)31-19-21-32(22-20-31)33-23-25-36(26-24-33)38-35-17-11-6-12-18-35/h3-27,38H,1H2,2H3/b29-27+,37-28- |
| InChIKey | YMJUWFURDYAJNB-ZBTPDPFWSA-N |
| XLogP | 10.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|