C39H31NO — CID 135299565
N-[4-[(1E)-1-(1-benzofuran-3-yl)buta-1,3-dien-2-yl]phenyl]-9,9-dimethyl-7-phenylfluoren-2-amine (PubChem CID 135299565) has the molecular formula C39H31NO and a molecular weight of 529.68 g/mol. Its IUPAC name is N-[4-[(1E)-1-(1-benzofuran-3-yl)buta-1,3-dien-2-yl]phenyl]-9,9-dimethyl-7-phenylfluoren-2-amine.
| Compound Name | N-[4-[(1E)-1-(1-benzofuran-3-yl)buta-1,3-dien-2-yl]phenyl]-9,9-dimethyl-7-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 135299565 |
| Molecular Formula | C39H31NO |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | N-[4-[(1E)-1-(1-benzofuran-3-yl)buta-1,3-dien-2-yl]phenyl]-9,9-dimethyl-7-phenylfluoren-2-amine |
| SMILES | C=C/C(=C\c1coc2ccccc12)c1ccc(Nc2ccc3c(c2)C(C)(C)c2cc(-c4ccccc4)ccc2-3)cc1 |
| InChI | InChI=1S/C39H31NO/c1-4-26(22-30-25-41-38-13-9-8-12-33(30)38)28-14-17-31(18-15-28)40-32-19-21-35-34-20-16-29(27-10-6-5-7-11-27)23-36(34)39(2,3)37(35)24-32/h4-25,40H,1H2,2-3H3/b26-22+ |
| InChIKey | JOBGKNFADSPRHS-XTCLZLMSSA-N |
| XLogP | 10.88 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|