About ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline
ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline (PubChem CID 145067455) has the molecular formula C25H25N
and a molecular weight of 339.48 g/mol. Its IUPAC name is ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline.
Molecular Properties
| Compound Name | ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline |
| PubChem CID | 145067455 |
| Molecular Formula | C25H25N |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline |
| SMILES | C=C.C=C/C(=C\C)c1ccc(Nc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H21N.C2H4/c1-3-18(4-2)20-10-14-22(15-11-20)24-23-16-12-21(13-17-23)19-8-6-5-7-9-19;1-2/h3-17,24H,1H2,2H3;1-2H2/b18-4+; |
| InChIKey | WRQHYWWKPNKHAP-BLSWVXOOSA-N |
| XLogP | 7.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline?
The IUPAC name of ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline (CID 145067455) is ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline.
What is the SMILES notation for ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline?
The canonical SMILES for ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline is C=C.C=C/C(=C\C)c1ccc(Nc2ccc(-c3ccccc3)cc2)cc1.
What is the InChIKey of ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline?
The InChIKey is WRQHYWWKPNKHAP-BLSWVXOOSA-N. The full InChI is InChI=1S/C23H21N.C2H4/c1-3-18(4-2)20-10-14-22(15-11-20)24-23-16-12-21(13-17-23)19-8-6-5-7-9-19;1-2/h3-17,24H,1H2,2H3;1-2H2/b18-4+;.
What are the key properties of ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline?
ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline has a molecular weight of 339.48 g/mol, XLogP of 7.49, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-4-phenylaniline is sourced from PubChem (CID 145067455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).