C48H37N — CID 145003943
4-(3,5-diphenylphenyl)-N-[4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]phenyl]aniline (PubChem CID 145003943) has the molecular formula C48H37N and a molecular weight of 627.83 g/mol. Its IUPAC name is 4-(3,5-diphenylphenyl)-N-[4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]phenyl]aniline.
| Compound Name | 4-(3,5-diphenylphenyl)-N-[4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]phenyl]aniline |
|---|---|
| PubChem CID | 145003943 |
| Molecular Formula | C48H37N |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | 4-(3,5-diphenylphenyl)-N-[4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]phenyl]aniline |
| SMILES | C=C/C=C(\C=C)c1cc(-c2ccccc2)cc(-c2ccc(Nc3ccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C48H37N/c1-3-14-35(4-2)41-29-42(36-15-8-5-9-16-36)32-45(30-41)39-21-25-47(26-22-39)49-48-27-23-40(24-28-48)46-33-43(37-17-10-6-11-18-37)31-44(34-46)38-19-12-7-13-20-38/h3-34,49H,1-2H2/b35-14+ |
| InChIKey | PBWORBZHKPFCEL-YRJKAGBCSA-N |
| XLogP | 13.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|