C42H33N3 — CID 145237279
2-(9,9-dimethylfluoren-1-yl)-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazine (PubChem CID 145237279) has the molecular formula C42H33N3 and a molecular weight of 579.75 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-1-yl)-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-1-yl)-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145237279 |
| Molecular Formula | C42H33N3 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 2-(9,9-dimethylfluoren-1-yl)-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C)c1cc(-c2ccccc2)cc(-c2nc(-c3ccccc3)nc(-c3cccc4c3C(C)(C)c3ccccc3-4)n2)c1 |
| InChI | InChI=1S/C42H33N3/c1-5-16-28(6-2)31-25-32(29-17-9-7-10-18-29)27-33(26-31)40-43-39(30-19-11-8-12-20-30)44-41(45-40)36-23-15-22-35-34-21-13-14-24-37(34)42(3,4)38(35)36/h5-27H,1-2H2,3-4H3/b28-16+ |
| InChIKey | SZGKJWNCKHKGSN-LQKURTRISA-N |
| XLogP | 10.60 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|