C42H31N3 — CID 129150867
2-[3-(9,9-dimethylfluoren-1-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 129150867) has the molecular formula C42H31N3 and a molecular weight of 577.73 g/mol. Its IUPAC name is 2-[3-(9,9-dimethylfluoren-1-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(9,9-dimethylfluoren-1-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 129150867 |
| Molecular Formula | C42H31N3 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 2-[3-(9,9-dimethylfluoren-1-yl)phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c3)c21 |
| InChI | InChI=1S/C42H31N3/c1-42(2)37-22-10-9-19-35(37)36-21-12-20-34(38(36)42)32-17-11-18-33(27-32)41-44-39(30-15-7-4-8-16-30)43-40(45-41)31-25-23-29(24-26-31)28-13-5-3-6-14-28/h3-27H,1-2H3 |
| InChIKey | AGLABUDCZFVLKR-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |