C55H40N2 — CID 126544515
2-(9,9-dimethylfluoren-1-yl)-4,6-bis(3,5-diphenylphenyl)pyrimidine (PubChem CID 126544515) has the molecular formula C55H40N2 and a molecular weight of 728.94 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-1-yl)-4,6-bis(3,5-diphenylphenyl)pyrimidine.
| Compound Name | 2-(9,9-dimethylfluoren-1-yl)-4,6-bis(3,5-diphenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 126544515 |
| Molecular Formula | C55H40N2 |
| Molecular Weight | 728.94 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | 2-(9,9-dimethylfluoren-1-yl)-4,6-bis(3,5-diphenylphenyl)pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2cccc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)c21 |
| InChI | InChI=1S/C55H40N2/c1-55(2)50-29-16-15-26-47(50)48-27-17-28-49(53(48)55)54-56-51(45-32-41(37-18-7-3-8-19-37)30-42(33-45)38-20-9-4-10-21-38)36-52(57-54)46-34-43(39-22-11-5-12-23-39)31-44(35-46)40-24-13-6-14-25-40/h3-36H,1-2H3 |
| InChIKey | YYXNHJUSFHLJQY-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.94 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |