C48H35N3O — CID 134237873
2-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 134237873) has the molecular formula C48H35N3O and a molecular weight of 669.83 g/mol. Its IUPAC name is 2-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 134237873 |
| Molecular Formula | C48H35N3O |
| Molecular Weight | 669.83 g/mol |
| Exact Mass | 669.28 |
| IUPAC Name | 2-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-4-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C)c1cccc(-c2nc(-c3cccc(-c4ccccc4)c3)nc(-c3ccc4c(c3)oc3c5c(ccc34)-c3ccccc3C5(C)C)n2)c1 |
| InChI | InChI=1S/C48H35N3O/c1-5-14-30(6-2)32-17-12-19-34(27-32)45-49-46(35-20-13-18-33(28-35)31-15-8-7-9-16-31)51-47(50-45)36-23-24-38-40-26-25-39-37-21-10-11-22-41(37)48(3,4)43(39)44(40)52-42(38)29-36/h5-29H,1-2H2,3-4H3/b30-14+ |
| InChIKey | FOUHJVQIAOZPDM-AMVVHIIESA-N |
| XLogP | 12.50 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.83 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|