C52H39N3O2 — CID 134243569
2-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-1-benzofuran-7-yl]-4-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-6-(9,9-dimethylfluoren-2-yl)-1,3,5-triazine (PubChem CID 134243569) has the molecular formula C52H39N3O2 and a molecular weight of 737.90 g/mol. Its IUPAC name is 2-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-1-benzofuran-7-yl]-4-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-6-(9,9-dimethylfluoren-2-yl)-1,3,5-triazine.
| Compound Name | 2-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-1-benzofuran-7-yl]-4-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-6-(9,9-dimethylfluoren-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 134243569 |
| Molecular Formula | C52H39N3O2 |
| Molecular Weight | 737.90 g/mol |
| Exact Mass | 737.30 |
| IUPAC Name | 2-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-1-benzofuran-7-yl]-4-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-6-(9,9-dimethylfluoren-2-yl)-1,3,5-triazine |
| SMILES | C=C/C=C\c1c(C)oc2c(-c3nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)nc(-c4ccc5c(c4)oc4c6c(ccc45)-c4ccccc4C6(C)C)n3)cccc12 |
| InChI | InChI=1S/C52H39N3O2/c1-7-8-14-32-29(2)56-46-38(32)17-13-18-40(46)50-54-48(30-21-23-35-33-15-9-11-19-41(33)51(3,4)43(35)27-30)53-49(55-50)31-22-24-36-39-26-25-37-34-16-10-12-20-42(34)52(5,6)45(37)47(39)57-44(36)28-31/h7-28H,1H2,2-6H3/b14-8- |
| InChIKey | AJRUNUQHPXXRQK-ZSOIEALJSA-N |
| XLogP | 13.64 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.90 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|