C42H29N3O — CID 130232482
2-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 130232482) has the molecular formula C42H29N3O and a molecular weight of 591.71 g/mol. Its IUPAC name is 2-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 130232482 |
| Molecular Formula | C42H29N3O |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 2-(12,12-dimethylfluoreno[1,2-b][1]benzofuran-9-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc3c(oc4cc(-c5nc(-c6ccccc6)nc(-c6cccc(-c7ccccc7)c6)n5)ccc43)c21 |
| InChI | InChI=1S/C42H29N3O/c1-42(2)35-19-10-9-18-31(35)33-22-23-34-32-21-20-30(25-36(32)46-38(34)37(33)42)41-44-39(27-14-7-4-8-15-27)43-40(45-41)29-17-11-16-28(24-29)26-12-5-3-6-13-26/h3-25H,1-2H3 |
| InChIKey | BXQPFPLWWRZVFQ-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |