C28H23N3 — CID 144834616
2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4-(3-methylphenyl)-6-phenyl-1,3,5-triazine (PubChem CID 144834616) has the molecular formula C28H23N3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4-(3-methylphenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4-(3-methylphenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 144834616 |
| Molecular Formula | C28H23N3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-4-(3-methylphenyl)-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C)c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C28H23N3/c1-4-10-21(5-2)22-15-17-24(18-16-22)27-29-26(23-12-7-6-8-13-23)30-28(31-27)25-14-9-11-20(3)19-25/h4-19H,1-2H2,3H3/b21-10+ |
| InChIKey | ZZNHBNUARQUDER-UFFVCSGVSA-N |
| XLogP | 6.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|