C48H34N6 — CID 145390977
2-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 145390977) has the molecular formula C48H34N6 and a molecular weight of 694.84 g/mol. Its IUPAC name is 2-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145390977 |
| Molecular Formula | C48H34N6 |
| Molecular Weight | 694.84 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | 2-[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-c2ccc(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cc3)cc2)n1 |
| InChI | InChI=1S/C48H34N6/c1-3-14-33(4-2)43-49-44(38-15-8-5-9-16-38)52-47(50-43)41-29-25-36(26-30-41)34-21-23-35(24-22-34)37-27-31-42(32-28-37)48-53-45(39-17-10-6-11-18-39)51-46(54-48)40-19-12-7-13-20-40/h3-32H,1-2H2/b33-14+ |
| InChIKey | WCQNMMXNEZAQSO-ZHSUKTGHSA-N |
| XLogP | 11.48 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.84 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|