C24H21N — CID 145280393
N-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-phenylaniline (PubChem CID 145280393) has the molecular formula C24H21N and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-phenylaniline.
| Compound Name | N-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-phenylaniline |
|---|---|
| PubChem CID | 145280393 |
| Molecular Formula | C24H21N |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-3-phenylaniline |
| SMILES | C=C/C=C(\C=C)c1cccc(Nc2cccc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H21N/c1-3-10-19(4-2)21-13-8-15-23(17-21)25-24-16-9-14-22(18-24)20-11-6-5-7-12-20/h3-18,25H,1-2H2/b19-10+ |
| InChIKey | FCNIDEXTLFFNCU-VXLYETTFSA-N |
| XLogP | 6.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|