C18H18 — CID 143872310
1-[(3E)-hexa-1,3-dien-3-yl]-3-phenylbenzene (PubChem CID 143872310) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3-dien-3-yl]-3-phenylbenzene.
| Compound Name | 1-[(3E)-hexa-1,3-dien-3-yl]-3-phenylbenzene |
|---|---|
| PubChem CID | 143872310 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-[(3E)-hexa-1,3-dien-3-yl]-3-phenylbenzene |
| SMILES | C=C/C(=C\CC)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H18/c1-3-9-15(4-2)17-12-8-13-18(14-17)16-10-6-5-7-11-16/h4-14H,2-3H2,1H3/b15-9+ |
| InChIKey | MCJSFWAVDKFXBP-OQLLNIDSSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|