C10H12 — CID 23063595
bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene (PubChem CID 23063595) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene |
|---|---|
| PubChem CID | 23063595 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene |
| SMILES | C=CCC.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C4H8/c1-2-5-4-6(5)3-1;1-3-4-2/h1-4H;3H,1,4H2,2H3 |
| InChIKey | GQWPTEUHGCNADP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|