About bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene
bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene (PubChem CID 23063595) has the molecular formula C10H12
and a molecular weight of 132.21 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene |
| PubChem CID | 23063595 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene |
| SMILES | C=CCC.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H4.C4H8/c1-2-5-4-6(5)3-1;1-3-4-2/h1-4H;3H,1,4H2,2H3 |
| InChIKey | GQWPTEUHGCNADP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene (CID 23063595) is bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene is C=CCC.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene?
The InChIKey is GQWPTEUHGCNADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C4H8/c1-2-5-4-6(5)3-1;1-3-4-2/h1-4H;3H,1,4H2,2H3.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene?
bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene has a molecular weight of 132.21 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;but-1-ene is sourced from PubChem (CID 23063595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).