C27H22 — CID 145452335
1,3-diphenyl-5-(3-prop-1-en-2-ylphenyl)benzene (PubChem CID 145452335) has the molecular formula C27H22 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1,3-diphenyl-5-(3-prop-1-en-2-ylphenyl)benzene.
| Compound Name | 1,3-diphenyl-5-(3-prop-1-en-2-ylphenyl)benzene |
|---|---|
| PubChem CID | 145452335 |
| Molecular Formula | C27H22 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1,3-diphenyl-5-(3-prop-1-en-2-ylphenyl)benzene |
| SMILES | C=C(C)c1cccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H22/c1-20(2)23-14-9-15-24(16-23)27-18-25(21-10-5-3-6-11-21)17-26(19-27)22-12-7-4-8-13-22/h3-19H,1H2,2H3 |
| InChIKey | FSIPNIYHVHXDPH-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |